C16H12ClN7O2S — CID 18686816
5-chloro-6-methyl-N-[(3-nitrophenyl)methyl]-2-(1,2,4-triazol-1-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 18686816) has the molecular formula C16H12ClN7O2S and a molecular weight of 401.84 g/mol. Its IUPAC name is 5-chloro-6-methyl-N-[(3-nitrophenyl)methyl]-2-(1,2,4-triazol-1-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-chloro-6-methyl-N-[(3-nitrophenyl)methyl]-2-(1,2,4-triazol-1-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18686816 |
| Molecular Formula | C16H12ClN7O2S |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 5-chloro-6-methyl-N-[(3-nitrophenyl)methyl]-2-(1,2,4-triazol-1-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(-n3cncn3)nc(NCc3cccc([N+](=O)[O-])c3)c2c1Cl |
| InChI | InChI=1S/C16H12ClN7O2S/c1-9-13(17)12-14(19-6-10-3-2-4-11(5-10)24(25)26)21-16(22-15(12)27-9)23-8-18-7-20-23/h2-5,7-8H,6H2,1H3,(H,19,21,22) |
| InChIKey | BWGZJLGMSRBLGU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|