C20H18N6O2S — CID 18460336
N-[(3-nitrophenyl)methyl]-2-pyrazol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 18460336) has the molecular formula C20H18N6O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-2-pyrazol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(3-nitrophenyl)methyl]-2-pyrazol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18460336 |
| Molecular Formula | C20H18N6O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-2-pyrazol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2nc(-n3cccn3)nc3sc4c(c23)CCCC4)c1 |
| InChI | InChI=1S/C20H18N6O2S/c27-26(28)14-6-3-5-13(11-14)12-21-18-17-15-7-1-2-8-16(15)29-19(17)24-20(23-18)25-10-4-9-22-25/h3-6,9-11H,1-2,7-8,12H2,(H,21,23,24) |
| InChIKey | ZVRJQBUFYRGDGV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|