C19H18N6S — CID 18686820
N-benzyl-2-(1,2,4-triazol-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 18686820) has the molecular formula C19H18N6S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-benzyl-2-(1,2,4-triazol-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-benzyl-2-(1,2,4-triazol-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18686820 |
| Molecular Formula | C19H18N6S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-benzyl-2-(1,2,4-triazol-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc(CNc2nc(-n3cncn3)nc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C19H18N6S/c1-2-6-13(7-3-1)10-21-17-16-14-8-4-5-9-15(14)26-18(16)24-19(23-17)25-12-20-11-22-25/h1-3,6-7,11-12H,4-5,8-10H2,(H,21,23,24) |
| InChIKey | UDCKAIZAHMWAOV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |