C20H17N5O2S — CID 18460299
5,6-dimethyl-N-[(3-nitrophenyl)methyl]-2-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 18460299) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 5,6-dimethyl-N-[(3-nitrophenyl)methyl]-2-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-N-[(3-nitrophenyl)methyl]-2-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18460299 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 5,6-dimethyl-N-[(3-nitrophenyl)methyl]-2-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(-c3ccncc3)nc(NCc3cccc([N+](=O)[O-])c3)c2c1C |
| InChI | InChI=1S/C20H17N5O2S/c1-12-13(2)28-20-17(12)19(23-18(24-20)15-6-8-21-9-7-15)22-11-14-4-3-5-16(10-14)25(26)27/h3-10H,11H2,1-2H3,(H,22,23,24) |
| InChIKey | WMCIXRQCXDCRFU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|