C21H16N4O4S — CID 23289596
4-[5-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid (PubChem CID 23289596) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is 4-[5-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid.
| Compound Name | 4-[5-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 23289596 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4-[5-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid |
| SMILES | Cc1csc2nc(-c3ccc(C(=O)O)cc3)nc(NCc3cccc([N+](=O)[O-])c3)c12 |
| InChI | InChI=1S/C21H16N4O4S/c1-12-11-30-20-17(12)19(22-10-13-3-2-4-16(9-13)25(28)29)23-18(24-20)14-5-7-15(8-6-14)21(26)27/h2-9,11H,10H2,1H3,(H,26,27)(H,22,23,24) |
| InChIKey | MMHQAHYPQGAKKC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|