C15H17N3O6S — CID 162517450
ethyl 5-[(2,4-dimethoxyphenyl)methylamino]-4-nitro-1,3-thiazole-2-carboxylate (PubChem CID 162517450) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is ethyl 5-[(2,4-dimethoxyphenyl)methylamino]-4-nitro-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 5-[(2,4-dimethoxyphenyl)methylamino]-4-nitro-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 162517450 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | ethyl 5-[(2,4-dimethoxyphenyl)methylamino]-4-nitro-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc([N+](=O)[O-])c(NCc2ccc(OC)cc2OC)s1 |
| InChI | InChI=1S/C15H17N3O6S/c1-4-24-15(19)14-17-12(18(20)21)13(25-14)16-8-9-5-6-10(22-2)7-11(9)23-3/h5-7,16H,4,8H2,1-3H3 |
| InChIKey | IHFIVIOBRQECDI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|