About ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate
ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate (PubChem CID 154984011) has the molecular formula C15H16N2O10S2
and a molecular weight of 448.43 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate |
| PubChem CID | 154984011 |
| Molecular Formula | C15H16N2O10S2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(O)c([N+](=O)[O-])s1.CCOC(=O)c1cc(OC)c([N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H9NO5S.C7H7NO5S/c1-3-14-8(10)6-4-5(13-2)7(15-6)9(11)12;1-2-13-7(10)5-3-4(9)6(14-5)8(11)12/h4H,3H2,1-2H3;3,9H,2H2,1H3 |
| InChIKey | QTWWPDWUGZHTNP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 168.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate?
The IUPAC name of ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate (CID 154984011) is ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate is CCOC(=O)c1cc(O)c([N+](=O)[O-])s1.CCOC(=O)c1cc(OC)c([N+](=O)[O-])s1.
What is the InChIKey of ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate?
The InChIKey is QTWWPDWUGZHTNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO5S.C7H7NO5S/c1-3-14-8(10)6-4-5(13-2)7(15-6)9(11)12;1-2-13-7(10)5-3-4(9)6(14-5)8(11)12/h4H,3H2,1-2H3;3,9H,2H2,1H3.
What are the key properties of ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate?
ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate has a molecular weight of 448.43 g/mol, XLogP of 3.38, 7 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-5-nitrothiophene-2-carboxylate;ethyl 4-methoxy-5-nitrothiophene-2-carboxylate is sourced from PubChem (CID 154984011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).