C8H10N2O3S — CID 139237272
ethyl 2-(methylamino)-4-oxo-1,3-thiazine-6-carboxylate (PubChem CID 139237272) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is ethyl 2-(methylamino)-4-oxo-1,3-thiazine-6-carboxylate.
| Compound Name | ethyl 2-(methylamino)-4-oxo-1,3-thiazine-6-carboxylate |
|---|---|
| PubChem CID | 139237272 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | ethyl 2-(methylamino)-4-oxo-1,3-thiazine-6-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)nc(NC)s1 |
| InChI | InChI=1S/C8H10N2O3S/c1-3-13-7(12)5-4-6(11)10-8(9-2)14-5/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | WHAFVRFVTWPNOU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |