C13H12N2O3S — CID 4097800
methyl 2-(4-methylanilino)-4-oxo-1,3-thiazine-6-carboxylate (PubChem CID 4097800) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is methyl 2-(4-methylanilino)-4-oxo-1,3-thiazine-6-carboxylate.
| Compound Name | methyl 2-(4-methylanilino)-4-oxo-1,3-thiazine-6-carboxylate |
|---|---|
| PubChem CID | 4097800 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | methyl 2-(4-methylanilino)-4-oxo-1,3-thiazine-6-carboxylate |
| SMILES | COC(=O)c1cc(=O)nc(Nc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C13H12N2O3S/c1-8-3-5-9(6-4-8)14-13-15-11(16)7-10(19-13)12(17)18-2/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | GWFPMUJNYYQLPA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |