About methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate
methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate (PubChem CID 15635438) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate |
| PubChem CID | 15635438 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate |
| SMILES | CCOc1nc(=O)cc(C(=O)OC)s1 |
| InChI | InChI=1S/C8H9NO4S/c1-3-13-8-9-6(10)4-5(14-8)7(11)12-2/h4H,3H2,1-2H3 |
| InChIKey | SPUWZMYCPBIJIY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate?
The IUPAC name of methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate (CID 15635438) is methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate.
What is the SMILES notation for methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate?
The canonical SMILES for methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate is CCOc1nc(=O)cc(C(=O)OC)s1.
What is the InChIKey of methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate?
The InChIKey is SPUWZMYCPBIJIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c1-3-13-8-9-6(10)4-5(14-8)7(11)12-2/h4H,3H2,1-2H3.
What are the key properties of methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate?
methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate has a molecular weight of 215.23 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethoxy-4-oxo-1,3-thiazine-6-carboxylate is sourced from PubChem (CID 15635438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).