C8H8N2O2S — CID 175731283
2-ethoxy-4H-[1,3]thiazolo[4,5-b]pyridin-5-one (PubChem CID 175731283) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-ethoxy-4H-[1,3]thiazolo[4,5-b]pyridin-5-one.
| Compound Name | 2-ethoxy-4H-[1,3]thiazolo[4,5-b]pyridin-5-one |
|---|---|
| PubChem CID | 175731283 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-ethoxy-4H-[1,3]thiazolo[4,5-b]pyridin-5-one |
| SMILES | CCOc1nc2[nH]c(=O)ccc2s1 |
| InChI | InChI=1S/C8H8N2O2S/c1-2-12-8-10-7-5(13-8)3-4-6(11)9-7/h3-4H,2H2,1H3,(H,9,11) |
| InChIKey | HQRJZGRCAKMZJG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |