C9H12N2OS — CID 145188413
ethane;5-methyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one (PubChem CID 145188413) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is ethane;5-methyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one.
| Compound Name | ethane;5-methyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 145188413 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | ethane;5-methyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
| SMILES | CC.Cc1ccc2sc(=O)[nH]c2n1 |
| InChI | InChI=1S/C7H6N2OS.C2H6/c1-4-2-3-5-6(8-4)9-7(10)11-5;1-2/h2-3H,1H3,(H,8,9,10);1-2H3 |
| InChIKey | RHTZMDYFTGAUHV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |