C11H7NOS — CID 14596408
1H-benzo[e][1,3]benzothiazol-2-one (PubChem CID 14596408) has the molecular formula C11H7NOS and a molecular weight of 201.25 g/mol. Its IUPAC name is 1H-benzo[e][1,3]benzothiazol-2-one.
| Compound Name | 1H-benzo[e][1,3]benzothiazol-2-one |
|---|---|
| PubChem CID | 14596408 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 1H-benzo[e][1,3]benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C11H7NOS/c13-11-12-10-8-4-2-1-3-7(8)5-6-9(10)14-11/h1-6H,(H,12,13) |
| InChIKey | NZROULYDNUMFJI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |