C10H6N2O2S — CID 90766437
1,5-dihydro-[1,3]thiazolo[5,4-c]quinoline-2,4-dione (PubChem CID 90766437) has the molecular formula C10H6N2O2S and a molecular weight of 218.24 g/mol. Its IUPAC name is 1,5-dihydro-[1,3]thiazolo[5,4-c]quinoline-2,4-dione.
| Compound Name | 1,5-dihydro-[1,3]thiazolo[5,4-c]quinoline-2,4-dione |
|---|---|
| PubChem CID | 90766437 |
| Molecular Formula | C10H6N2O2S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 1,5-dihydro-[1,3]thiazolo[5,4-c]quinoline-2,4-dione |
| SMILES | O=c1[nH]c2c(s1)c(=O)[nH]c1ccccc12 |
| InChI | InChI=1S/C10H6N2O2S/c13-9-8-7(12-10(14)15-8)5-3-1-2-4-6(5)11-9/h1-4H,(H,11,13)(H,12,14) |
| InChIKey | ZHTBQTGGJOANOX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |