C16H8ClNO2S — CID 90646445
10-chloro-5H-thiochromeno[2,3-c]quinoline-6,12-dione (PubChem CID 90646445) has the molecular formula C16H8ClNO2S and a molecular weight of 313.77 g/mol. Its IUPAC name is 10-chloro-5H-thiochromeno[2,3-c]quinoline-6,12-dione.
| Compound Name | 10-chloro-5H-thiochromeno[2,3-c]quinoline-6,12-dione |
|---|---|
| PubChem CID | 90646445 |
| Molecular Formula | C16H8ClNO2S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 10-chloro-5H-thiochromeno[2,3-c]quinoline-6,12-dione |
| SMILES | O=c1[nH]c2ccccc2c2c(=O)c3cc(Cl)ccc3sc12 |
| InChI | InChI=1S/C16H8ClNO2S/c17-8-5-6-12-10(7-8)14(19)13-9-3-1-2-4-11(9)18-16(20)15(13)21-12/h1-7H,(H,18,20) |
| InChIKey | OZOWYVRTMXFMOE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|