C13H22N2OS — CID 169136308
ethane;4,6,7-trimethyl-3H-[1,3]thiazolo[4,5-c]pyridin-2-one (PubChem CID 169136308) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is ethane;4,6,7-trimethyl-3H-[1,3]thiazolo[4,5-c]pyridin-2-one.
| Compound Name | ethane;4,6,7-trimethyl-3H-[1,3]thiazolo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 169136308 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethane;4,6,7-trimethyl-3H-[1,3]thiazolo[4,5-c]pyridin-2-one |
| SMILES | CC.CC.Cc1nc(C)c2[nH]c(=O)sc2c1C |
| InChI | InChI=1S/C9H10N2OS.2C2H6/c1-4-5(2)10-6(3)7-8(4)13-9(12)11-7;2*1-2/h1-3H3,(H,11,12);2*1-2H3 |
| InChIKey | KQJUVJQMBQTWRF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |