C7H11N3O — CID 135401759
4,5-dimethyl-2-(methylamino)-1H-pyrimidin-6-one (PubChem CID 135401759) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 4,5-dimethyl-2-(methylamino)-1H-pyrimidin-6-one.
| Compound Name | 4,5-dimethyl-2-(methylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135401759 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 4,5-dimethyl-2-(methylamino)-1H-pyrimidin-6-one |
| SMILES | CNc1nc(C)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O/c1-4-5(2)9-7(8-3)10-6(4)11/h1-3H3,(H2,8,9,10,11) |
| InChIKey | IFOLNWVBRSCJOJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |