C8H15N3O — CID 145166699
ethane;4-methyl-2-(methylamino)-1H-pyrimidin-6-one (PubChem CID 145166699) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is ethane;4-methyl-2-(methylamino)-1H-pyrimidin-6-one.
| Compound Name | ethane;4-methyl-2-(methylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145166699 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | ethane;4-methyl-2-(methylamino)-1H-pyrimidin-6-one |
| SMILES | CC.CNc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C6H9N3O.C2H6/c1-4-3-5(10)9-6(7-2)8-4;1-2/h3H,1-2H3,(H2,7,8,9,10);1-2H3 |
| InChIKey | IRDXEPCHTRRPSS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |