C7H10N4OS — CID 135981087
1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)thiourea (PubChem CID 135981087) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is 1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)thiourea.
| Compound Name | 1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 135981087 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)thiourea |
| SMILES | CNC(=S)Nc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H10N4OS/c1-4-3-5(12)10-6(9-4)11-7(13)8-2/h3H,1-2H3,(H3,8,9,10,11,12,13) |
| InChIKey | BPQDUSCKPUYOBB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|