C5H6N4O2 — CID 137229327
N-(4-methyl-6-oxo-1H-pyrimidin-2-yl)nitrous amide (PubChem CID 137229327) has the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. Its IUPAC name is N-(4-methyl-6-oxo-1H-pyrimidin-2-yl)nitrous amide.
| Compound Name | N-(4-methyl-6-oxo-1H-pyrimidin-2-yl)nitrous amide |
|---|---|
| PubChem CID | 137229327 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | N-(4-methyl-6-oxo-1H-pyrimidin-2-yl)nitrous amide |
| SMILES | Cc1cc(=O)[nH]c(NN=O)n1 |
| InChI | InChI=1S/C5H6N4O2/c1-3-2-4(10)7-5(6-3)8-9-11/h2H,1H3,(H2,6,7,8,10,11) |
| InChIKey | DGQQQDKENAODSJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|