C8H9N4O3- — CID 135593603
(2E)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]propanoate (PubChem CID 135593603) has the molecular formula C8H9N4O3- and a molecular weight of 209.19 g/mol. Its IUPAC name is (2E)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]propanoate.
| Compound Name | (2E)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 135593603 |
| Molecular Formula | C8H9N4O3- |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2E)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]propanoate |
| SMILES | C/C(=N\Nc1nc(C)cc(=O)[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C8H10N4O3/c1-4-3-6(13)10-8(9-4)12-11-5(2)7(14)15/h3H,1-2H3,(H,14,15)(H2,9,10,12,13)/p-1/b11-5+ |
| InChIKey | WRWMCDGJBXKZQH-VZUCSPMQSA-M |
| XLogP | -1.38 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|