C21H20N4O — CID 136795191
2-[(2E)-2-[(E)-1,3-diphenylbut-2-enylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136795191) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-1,3-diphenylbut-2-enylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2E)-2-[(E)-1,3-diphenylbut-2-enylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136795191 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[(2E)-2-[(E)-1,3-diphenylbut-2-enylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | C/C(=C\C(=N/Nc1nc(C)cc(=O)[nH]1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N4O/c1-15(17-9-5-3-6-10-17)13-19(18-11-7-4-8-12-18)24-25-21-22-16(2)14-20(26)23-21/h3-14H,1-2H3,(H2,22,23,25,26)/b15-13+,24-19+ |
| InChIKey | QHGXJCQYAFKFJZ-GHYOEHOBSA-N |
| XLogP | 4.00 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|