C7HCl4NOS — CID 13447021
4,5,6,7-tetrachloro-3H-1,3-benzothiazol-2-one (PubChem CID 13447021) has the molecular formula C7HCl4NOS and a molecular weight of 288.97 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3H-1,3-benzothiazol-2-one.
| Compound Name | 4,5,6,7-tetrachloro-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 13447021 |
| Molecular Formula | C7HCl4NOS |
| Molecular Weight | 288.97 g/mol |
| Exact Mass | 286.85 |
| IUPAC Name | 4,5,6,7-tetrachloro-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(Cl)c(Cl)c(Cl)c(Cl)c2s1 |
| InChI | InChI=1S/C7HCl4NOS/c8-1-2(9)4(11)6-5(3(1)10)12-7(13)14-6/h(H,12,13) |
| InChIKey | HEYGHKSSMDAUNJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.97 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|