C7H13NOS — CID 143431623
4,5-dimethyl-3H-1,3-thiazol-2-one;ethane (PubChem CID 143431623) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is 4,5-dimethyl-3H-1,3-thiazol-2-one;ethane.
| Compound Name | 4,5-dimethyl-3H-1,3-thiazol-2-one;ethane |
|---|---|
| PubChem CID | 143431623 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 4,5-dimethyl-3H-1,3-thiazol-2-one;ethane |
| SMILES | CC.Cc1[nH]c(=O)sc1C |
| InChI | InChI=1S/C5H7NOS.C2H6/c1-3-4(2)8-5(7)6-3;1-2/h1-2H3,(H,6,7);1-2H3 |
| InChIKey | AUYNXDALXNGALB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |