C10H9NO2S — CID 11506705
6,8-dimethyl-1,3-benzothiazine-2,4-dione (PubChem CID 11506705) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 6,8-dimethyl-1,3-benzothiazine-2,4-dione.
| Compound Name | 6,8-dimethyl-1,3-benzothiazine-2,4-dione |
|---|---|
| PubChem CID | 11506705 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 6,8-dimethyl-1,3-benzothiazine-2,4-dione |
| SMILES | Cc1cc(C)c2sc(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C10H9NO2S/c1-5-3-6(2)8-7(4-5)9(12)11-10(13)14-8/h3-4H,1-2H3,(H,11,12,13) |
| InChIKey | ANAPBYNBRXYCHI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |