C11H13N3O — CID 139618473
2,4-diethyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 139618473) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 2,4-diethyl-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2,4-diethyl-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 139618473 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2,4-diethyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCc1nc(CC)c2ccc(=O)[nH]c2n1 |
| InChI | InChI=1S/C11H13N3O/c1-3-8-7-5-6-10(15)14-11(7)13-9(4-2)12-8/h5-6H,3-4H2,1-2H3,(H,12,13,14,15) |
| InChIKey | WWHHAVPUERQZDI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |