C14H11N3O — CID 12795382
4-methyl-2-phenyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 12795382) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-methyl-2-phenyl-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-methyl-2-phenyl-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 12795382 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-methyl-2-phenyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(-c2ccccc2)nc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C14H11N3O/c1-9-11-7-8-12(18)16-14(11)17-13(15-9)10-5-3-2-4-6-10/h2-8H,1H3,(H,15,16,17,18) |
| InChIKey | ODTVYRCNBXYYEU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |