C10H14N2O4S — CID 27277044
diethyl 2-(methylamino)-1,3-thiazole-4,5-dicarboxylate (PubChem CID 27277044) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is diethyl 2-(methylamino)-1,3-thiazole-4,5-dicarboxylate.
| Compound Name | diethyl 2-(methylamino)-1,3-thiazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 27277044 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | diethyl 2-(methylamino)-1,3-thiazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(NC)sc1C(=O)OCC |
| InChI | InChI=1S/C10H14N2O4S/c1-4-15-8(13)6-7(9(14)16-5-2)17-10(11-3)12-6/h4-5H2,1-3H3,(H,11,12) |
| InChIKey | MQDCKWGKYRVXLH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |