About 1-diazo-2-nitroguanidine
1-diazo-2-nitroguanidine (PubChem CID 139058189) has the molecular formula C2H4N12O4
and a molecular weight of 260.13 g/mol. Its IUPAC name is 1-diazo-2-nitroguanidine.
Molecular Properties
| Compound Name | 1-diazo-2-nitroguanidine |
| PubChem CID | 139058189 |
| Molecular Formula | C2H4N12O4 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-diazo-2-nitroguanidine |
| SMILES | [N-]=[N+]=N/C(N)=N/[N+](=O)[O-].[N-]=[N+]=N/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/2CH2N6O2/c2*2-1(4-6-3)5-7(8)9/h2*(H2,2,5) |
| InChIKey | UIHJTVWJJBLJNE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 260.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-2-nitroguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-2-nitroguanidine?
The IUPAC name of 1-diazo-2-nitroguanidine (CID 139058189) is 1-diazo-2-nitroguanidine.
What is the SMILES notation for 1-diazo-2-nitroguanidine?
The canonical SMILES for 1-diazo-2-nitroguanidine is [N-]=[N+]=N/C(N)=N/[N+](=O)[O-].[N-]=[N+]=N/C(N)=N/[N+](=O)[O-].
What is the InChIKey of 1-diazo-2-nitroguanidine?
The InChIKey is UIHJTVWJJBLJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH2N6O2/c2*2-1(4-6-3)5-7(8)9/h2*(H2,2,5).
What are the key properties of 1-diazo-2-nitroguanidine?
1-diazo-2-nitroguanidine has a molecular weight of 260.13 g/mol, XLogP of -0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-2-nitroguanidine is sourced from PubChem (CID 139058189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).