About [azido-(N'-nitrocarbamimidoyl)amino]urea
[azido-(N'-nitrocarbamimidoyl)amino]urea (PubChem CID 154101531) has the molecular formula C2H5N9O3
and a molecular weight of 203.12 g/mol. Its IUPAC name is [azido-(N'-nitrocarbamimidoyl)amino]urea.
Molecular Properties
| Compound Name | [azido-(N'-nitrocarbamimidoyl)amino]urea |
| PubChem CID | 154101531 |
| Molecular Formula | C2H5N9O3 |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | [azido-(N'-nitrocarbamimidoyl)amino]urea |
| SMILES | [N-]=[N+]=NN(NC(N)=O)C(N)=N[N+](=O)[O-] |
| InChI | InChI=1S/C2H5N9O3/c3-1(6-11(13)14)10(9-8-5)7-2(4)12/h(H2,3,6)(H3,4,7,12) |
| InChIKey | IOOWQOSWLBITHB-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [azido-(N'-nitrocarbamimidoyl)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [azido-(N'-nitrocarbamimidoyl)amino]urea?
The IUPAC name of [azido-(N'-nitrocarbamimidoyl)amino]urea (CID 154101531) is [azido-(N'-nitrocarbamimidoyl)amino]urea.
What is the SMILES notation for [azido-(N'-nitrocarbamimidoyl)amino]urea?
The canonical SMILES for [azido-(N'-nitrocarbamimidoyl)amino]urea is [N-]=[N+]=NN(NC(N)=O)C(N)=N[N+](=O)[O-].
What is the InChIKey of [azido-(N'-nitrocarbamimidoyl)amino]urea?
The InChIKey is IOOWQOSWLBITHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N9O3/c3-1(6-11(13)14)10(9-8-5)7-2(4)12/h(H2,3,6)(H3,4,7,12).
What are the key properties of [azido-(N'-nitrocarbamimidoyl)amino]urea?
[azido-(N'-nitrocarbamimidoyl)amino]urea has a molecular weight of 203.12 g/mol, XLogP of -1.40, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [azido-(N'-nitrocarbamimidoyl)amino]urea is sourced from PubChem (CID 154101531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).