About (2-diazohydrazinyl)urea
(2-diazohydrazinyl)urea (PubChem CID 87973262) has the molecular formula CH4N6O
and a molecular weight of 116.08 g/mol. Its IUPAC name is (2-diazohydrazinyl)urea.
Molecular Properties
| Compound Name | (2-diazohydrazinyl)urea |
| PubChem CID | 87973262 |
| Molecular Formula | CH4N6O |
| Molecular Weight | 116.08 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | (2-diazohydrazinyl)urea |
| SMILES | [N-]=[N+]=NNNC(N)=O |
| InChI | InChI=1S/CH4N6O/c2-1(8)4-6-7-5-3/h6H,(H3,2,4,8) |
| InChIKey | DYJNUXZSHUMHEB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.08 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2-diazohydrazinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-diazohydrazinyl)urea?
The IUPAC name of (2-diazohydrazinyl)urea (CID 87973262) is (2-diazohydrazinyl)urea.
What is the SMILES notation for (2-diazohydrazinyl)urea?
The canonical SMILES for (2-diazohydrazinyl)urea is [N-]=[N+]=NNNC(N)=O.
What is the InChIKey of (2-diazohydrazinyl)urea?
The InChIKey is DYJNUXZSHUMHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N6O/c2-1(8)4-6-7-5-3/h6H,(H3,2,4,8).
What are the key properties of (2-diazohydrazinyl)urea?
(2-diazohydrazinyl)urea has a molecular weight of 116.08 g/mol, XLogP of -0.62, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-diazohydrazinyl)urea is sourced from PubChem (CID 87973262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).