About N-azido-2,2,2-trifluoroacetamide
N-azido-2,2,2-trifluoroacetamide (PubChem CID 54361791) has the molecular formula C2HF3N4O
and a molecular weight of 154.05 g/mol. Its IUPAC name is N-azido-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-azido-2,2,2-trifluoroacetamide |
| PubChem CID | 54361791 |
| Molecular Formula | C2HF3N4O |
| Molecular Weight | 154.05 g/mol |
| Exact Mass | 154.01 |
| IUPAC Name | N-azido-2,2,2-trifluoroacetamide |
| SMILES | [N-]=[N+]=NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C2HF3N4O/c3-2(4,5)1(10)7-9-8-6/h(H,7,10) |
| InChIKey | UNAGWTFYUPVVDD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.05 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-azido-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-azido-2,2,2-trifluoroacetamide?
The IUPAC name of N-azido-2,2,2-trifluoroacetamide (CID 54361791) is N-azido-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-azido-2,2,2-trifluoroacetamide?
The canonical SMILES for N-azido-2,2,2-trifluoroacetamide is [N-]=[N+]=NNC(=O)C(F)(F)F.
What is the InChIKey of N-azido-2,2,2-trifluoroacetamide?
The InChIKey is UNAGWTFYUPVVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF3N4O/c3-2(4,5)1(10)7-9-8-6/h(H,7,10).
What are the key properties of N-azido-2,2,2-trifluoroacetamide?
N-azido-2,2,2-trifluoroacetamide has a molecular weight of 154.05 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-azido-2,2,2-trifluoroacetamide is sourced from PubChem (CID 54361791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).