About propylaminourea
propylaminourea (PubChem CID 55291175) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is propylaminourea.
Molecular Properties
| Compound Name | propylaminourea |
| PubChem CID | 55291175 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | propylaminourea |
| SMILES | CCCNNC(N)=O |
| InChI | InChI=1S/C4H11N3O/c1-2-3-6-7-4(5)8/h6H,2-3H2,1H3,(H3,5,7,8) |
| InChIKey | IZPKADFECHOBLR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propylaminourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylaminourea?
The IUPAC name of propylaminourea (CID 55291175) is propylaminourea.
What is the SMILES notation for propylaminourea?
The canonical SMILES for propylaminourea is CCCNNC(N)=O.
What is the InChIKey of propylaminourea?
The InChIKey is IZPKADFECHOBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c1-2-3-6-7-4(5)8/h6H,2-3H2,1H3,(H3,5,7,8).
What are the key properties of propylaminourea?
propylaminourea has a molecular weight of 117.15 g/mol, XLogP of -0.43, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propylaminourea is sourced from PubChem (CID 55291175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).