2-(2-propylhydrazinyl)acetic acid

C5H12N2O2 — CID 140974960

IUPAC2-(2-propylhydrazinyl)acetic acid
SMILESCCCNNCC(=O)O
InChIInChI=1S/C5H12N2O2/c1-2-3-6-7-4-5(8)9/h6-7H,2-4H2,1H3,(H,8,9)
InChIKeyNACNBPOCIPIHCY-UHFFFAOYSA-N
MW132.16 g/mol
LogP-0.42
Rot. Bonds5

About 2-(2-propylhydrazinyl)acetic acid

2-(2-propylhydrazinyl)acetic acid (PubChem CID 140974960) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-(2-propylhydrazinyl)acetic acid.

Molecular Properties

Compound Name2-(2-propylhydrazinyl)acetic acid
PubChem CID140974960
Molecular FormulaC5H12N2O2
Molecular Weight132.16 g/mol
Exact Mass132.09
IUPAC Name2-(2-propylhydrazinyl)acetic acid
SMILESCCCNNCC(=O)O
InChIInChI=1S/C5H12N2O2/c1-2-3-6-7-4-5(8)9/h6-7H,2-4H2,1H3,(H,8,9)
InChIKeyNACNBPOCIPIHCY-UHFFFAOYSA-N
XLogP-0.42
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.16
LogP ≤ 5-0.42
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2-propylhydrazinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2-butylhydrazinyl)acetic acid
CID 90278440
acetic acid;1-octadecyl-2-propylhydrazine
CID 22323613
propylaminourea
CID 55291175
2-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-(tetradecylamino)butylamino]butylamino]butylamino]butylamino]butylamino]butylamino]butylamino]butylamino]butylamino]butylamino]butylamino]butylamino]acetic acid
CID 175074033
2-(2-butoxycarbonylhydrazinyl)acetic acid
CID 154371551
ethane;3-(propylamino)propanoic acid
CID 145416081
hexanedioic acid;N-propylpropan-1-amine
CID 88686443
ethane;propylcarbamic acid
CID 155733503
sodium;2-(hexadecylamino)acetic acid;hydride
CID 174739572
2-[2-[2-(hexadecylamino)ethylamino]ethylamino]acetic acid
CID 10091506
2-(1-hydroxypropan-2-ylamino)acetic acid;2-(propylamino)acetic acid
CID 160542223
2-(heptylcarbamoylamino)acetic acid
CID 43129060

Frequently Asked Questions

What is the IUPAC name of 2-(2-propylhydrazinyl)acetic acid?
The IUPAC name of 2-(2-propylhydrazinyl)acetic acid (CID 140974960) is 2-(2-propylhydrazinyl)acetic acid.
What is the SMILES notation for 2-(2-propylhydrazinyl)acetic acid?
The canonical SMILES for 2-(2-propylhydrazinyl)acetic acid is CCCNNCC(=O)O.
What is the InChIKey of 2-(2-propylhydrazinyl)acetic acid?
The InChIKey is NACNBPOCIPIHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-2-3-6-7-4-5(8)9/h6-7H,2-4H2,1H3,(H,8,9).
What are the key properties of 2-(2-propylhydrazinyl)acetic acid?
2-(2-propylhydrazinyl)acetic acid has a molecular weight of 132.16 g/mol, XLogP of -0.42, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propylhydrazinyl)acetic acid is sourced from PubChem (CID 140974960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).