About N-(methylaminomethoxymethyl)-N'-nitroethanimidamide
N-(methylaminomethoxymethyl)-N'-nitroethanimidamide (PubChem CID 172956423) has the molecular formula C5H12N4O3
and a molecular weight of 176.18 g/mol. Its IUPAC name is N-(methylaminomethoxymethyl)-N'-nitroethanimidamide.
Molecular Properties
| Compound Name | N-(methylaminomethoxymethyl)-N'-nitroethanimidamide |
| PubChem CID | 172956423 |
| Molecular Formula | C5H12N4O3 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | N-(methylaminomethoxymethyl)-N'-nitroethanimidamide |
| SMILES | CNCOCN/C(C)=N\[N+](=O)[O-] |
| InChI | InChI=1S/C5H12N4O3/c1-5(8-9(10)11)7-4-12-3-6-2/h6H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | FVQFVFNWWFRDPI-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze N-(methylaminomethoxymethyl)-N'-nitroethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(methylaminomethoxymethyl)-N'-nitroethanimidamide?
The IUPAC name of N-(methylaminomethoxymethyl)-N'-nitroethanimidamide (CID 172956423) is N-(methylaminomethoxymethyl)-N'-nitroethanimidamide.
What is the SMILES notation for N-(methylaminomethoxymethyl)-N'-nitroethanimidamide?
The canonical SMILES for N-(methylaminomethoxymethyl)-N'-nitroethanimidamide is CNCOCN/C(C)=N\[N+](=O)[O-].
What is the InChIKey of N-(methylaminomethoxymethyl)-N'-nitroethanimidamide?
The InChIKey is FVQFVFNWWFRDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O3/c1-5(8-9(10)11)7-4-12-3-6-2/h6H,3-4H2,1-2H3,(H,7,8).
What are the key properties of N-(methylaminomethoxymethyl)-N'-nitroethanimidamide?
N-(methylaminomethoxymethyl)-N'-nitroethanimidamide has a molecular weight of 176.18 g/mol, XLogP of -0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(methylaminomethoxymethyl)-N'-nitroethanimidamide is sourced from PubChem (CID 172956423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).