About ethyl N,N-dimethyl-N'-nitrocarbamimidate
ethyl N,N-dimethyl-N'-nitrocarbamimidate (PubChem CID 87633154) has the molecular formula C5H11N3O3
and a molecular weight of 161.16 g/mol. Its IUPAC name is ethyl N,N-dimethyl-N'-nitrocarbamimidate.
Molecular Properties
| Compound Name | ethyl N,N-dimethyl-N'-nitrocarbamimidate |
| PubChem CID | 87633154 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | ethyl N,N-dimethyl-N'-nitrocarbamimidate |
| SMILES | CCOC(=N[N+](=O)[O-])N(C)C |
| InChI | InChI=1S/C5H11N3O3/c1-4-11-5(7(2)3)6-8(9)10/h4H2,1-3H3 |
| InChIKey | SPKXXIWFOMLVPN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N,N-dimethyl-N'-nitrocarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N,N-dimethyl-N'-nitrocarbamimidate?
The IUPAC name of ethyl N,N-dimethyl-N'-nitrocarbamimidate (CID 87633154) is ethyl N,N-dimethyl-N'-nitrocarbamimidate.
What is the SMILES notation for ethyl N,N-dimethyl-N'-nitrocarbamimidate?
The canonical SMILES for ethyl N,N-dimethyl-N'-nitrocarbamimidate is CCOC(=N[N+](=O)[O-])N(C)C.
What is the InChIKey of ethyl N,N-dimethyl-N'-nitrocarbamimidate?
The InChIKey is SPKXXIWFOMLVPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O3/c1-4-11-5(7(2)3)6-8(9)10/h4H2,1-3H3.
What are the key properties of ethyl N,N-dimethyl-N'-nitrocarbamimidate?
ethyl N,N-dimethyl-N'-nitrocarbamimidate has a molecular weight of 161.16 g/mol, XLogP of 0.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N,N-dimethyl-N'-nitrocarbamimidate is sourced from PubChem (CID 87633154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).