C11H21N3 — CID 142057491
N-methylethanamine;(2Z,4Z)-3-(methylideneamino)hepta-2,4,6-trien-2-amine (PubChem CID 142057491) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N-methylethanamine;(2Z,4Z)-3-(methylideneamino)hepta-2,4,6-trien-2-amine.
| Compound Name | N-methylethanamine;(2Z,4Z)-3-(methylideneamino)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 142057491 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-methylethanamine;(2Z,4Z)-3-(methylideneamino)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C(N=C)=C(/C)N.CCNC |
| InChI | InChI=1S/C8H12N2.C3H9N/c1-4-5-6-8(10-3)7(2)9;1-3-4-2/h4-6H,1,3,9H2,2H3;4H,3H2,1-2H3/b6-5-,8-7-; |
| InChIKey | FMAXOIXLNPRDSX-OICKEEGDSA-N |
| XLogP | 1.85 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|