C9H15NS — CID 123333106
N-methyl-1-methylsulfanylhepta-4,6-dien-3-imine (PubChem CID 123333106) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is N-methyl-1-methylsulfanylhepta-4,6-dien-3-imine.
| Compound Name | N-methyl-1-methylsulfanylhepta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 123333106 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-methyl-1-methylsulfanylhepta-4,6-dien-3-imine |
| SMILES | C=CC=C/C(CCSC)=N\C |
| InChI | InChI=1S/C9H15NS/c1-4-5-6-9(10-2)7-8-11-3/h4-6H,1,7-8H2,2-3H3/b6-5?,10-9+ |
| InChIKey | MCDSTHIWLZBGPO-ZFZICBQDSA-N |
| XLogP | 2.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|