C12H18OS — CID 154930188
(3Z,5Z)-5-(3-methylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol (PubChem CID 154930188) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is (3Z,5Z)-5-(3-methylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol.
| Compound Name | (3Z,5Z)-5-(3-methylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol |
|---|---|
| PubChem CID | 154930188 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (3Z,5Z)-5-(3-methylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol |
| SMILES | C=C/C=C(\C=C/C(=C)O)CCCSC |
| InChI | InChI=1S/C12H18OS/c1-4-6-12(7-5-10-14-3)9-8-11(2)13/h4,6,8-9,13H,1-2,5,7,10H2,3H3/b9-8-,12-6- |
| InChIKey | WRUQEXZBNHZLSX-GNXJPQOPSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|