About 5-aminopentanoic acid;4-methylsulfanylbutanoic acid
5-aminopentanoic acid;4-methylsulfanylbutanoic acid (PubChem CID 170707208) has the molecular formula C10H21NO4S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-aminopentanoic acid;4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | 5-aminopentanoic acid;4-methylsulfanylbutanoic acid |
| PubChem CID | 170707208 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 5-aminopentanoic acid;4-methylsulfanylbutanoic acid |
| SMILES | CSCCCC(=O)O.NCCCCC(=O)O |
| InChI | InChI=1S/C5H11NO2.C5H10O2S/c6-4-2-1-3-5(7)8;1-8-4-2-3-5(6)7/h1-4,6H2,(H,7,8);2-4H2,1H3,(H,6,7) |
| InChIKey | FUPPGNKBXPLSKI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-aminopentanoic acid;4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopentanoic acid;4-methylsulfanylbutanoic acid?
The IUPAC name of 5-aminopentanoic acid;4-methylsulfanylbutanoic acid (CID 170707208) is 5-aminopentanoic acid;4-methylsulfanylbutanoic acid.
What is the SMILES notation for 5-aminopentanoic acid;4-methylsulfanylbutanoic acid?
The canonical SMILES for 5-aminopentanoic acid;4-methylsulfanylbutanoic acid is CSCCCC(=O)O.NCCCCC(=O)O.
What is the InChIKey of 5-aminopentanoic acid;4-methylsulfanylbutanoic acid?
The InChIKey is FUPPGNKBXPLSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C5H10O2S/c6-4-2-1-3-5(7)8;1-8-4-2-3-5(6)7/h1-4,6H2,(H,7,8);2-4H2,1H3,(H,6,7).
What are the key properties of 5-aminopentanoic acid;4-methylsulfanylbutanoic acid?
5-aminopentanoic acid;4-methylsulfanylbutanoic acid has a molecular weight of 251.35 g/mol, XLogP of 1.41, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopentanoic acid;4-methylsulfanylbutanoic acid is sourced from PubChem (CID 170707208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).