C20H32N2 — CID 143995417
ethane;N-[(3Z)-5-methylhexa-3,5-dien-3-yl]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]ethanimidamide (PubChem CID 143995417) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is ethane;N-[(3Z)-5-methylhexa-3,5-dien-3-yl]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]ethanimidamide.
| Compound Name | ethane;N-[(3Z)-5-methylhexa-3,5-dien-3-yl]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 143995417 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | ethane;N-[(3Z)-5-methylhexa-3,5-dien-3-yl]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]ethanimidamide |
| SMILES | C=C/C=C(\C=C/C)C(=C)/N=C(\C)N/C(=C\C(=C)C)CC.CC |
| InChI | InChI=1S/C18H26N2.C2H6/c1-8-11-17(12-9-2)15(6)19-16(7)20-18(10-3)13-14(4)5;1-2/h8-9,11-13H,1,4,6,10H2,2-3,5,7H3,(H,19,20);1-2H3/b12-9-,17-11+,18-13-; |
| InChIKey | FUHYHOOAJXAYJQ-CQSGXPRLSA-N |
| XLogP | 6.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|