C10H14N2 — CID 123749804
5-ethyl-3-methylidene-N-prop-1-en-2-ylpyrrol-2-amine (PubChem CID 123749804) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 5-ethyl-3-methylidene-N-prop-1-en-2-ylpyrrol-2-amine.
| Compound Name | 5-ethyl-3-methylidene-N-prop-1-en-2-ylpyrrol-2-amine |
|---|---|
| PubChem CID | 123749804 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 5-ethyl-3-methylidene-N-prop-1-en-2-ylpyrrol-2-amine |
| SMILES | C=C(C)NC1=NC(CC)=CC1=C |
| InChI | InChI=1S/C10H14N2/c1-5-9-6-8(4)10(12-9)11-7(2)3/h6H,2,4-5H2,1,3H3,(H,11,12) |
| InChIKey | HHGSPLBRLANGQA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |