C12H19N5 — CID 176519651
3-[amino-[(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methylidene]-1,1-dimethylguanidine (PubChem CID 176519651) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 3-[amino-[(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methylidene]-1,1-dimethylguanidine.
| Compound Name | 3-[amino-[(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methylidene]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 176519651 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 3-[amino-[(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methylidene]-1,1-dimethylguanidine |
| SMILES | [H]/N=C(/N=C(N)NC1=CC=C(C)CC=C1)N(C)C |
| InChI | InChI=1S/C12H19N5/c1-9-5-4-6-10(8-7-9)15-11(13)16-12(14)17(2)3/h4,6-8H,5H2,1-3H3,(H4,13,14,15,16) |
| InChIKey | UDSRBTKHBHNHOM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|