C15H22N4 — CID 145496993
2-[1-(ethenylamino)-2-methylprop-1-enyl]-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-3-methylideneguanidine (PubChem CID 145496993) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[1-(ethenylamino)-2-methylprop-1-enyl]-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-3-methylideneguanidine.
| Compound Name | 2-[1-(ethenylamino)-2-methylprop-1-enyl]-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-3-methylideneguanidine |
|---|---|
| PubChem CID | 145496993 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-[1-(ethenylamino)-2-methylprop-1-enyl]-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-3-methylideneguanidine |
| SMILES | C=CNC(/N=C(\N=C)N/C(C=C)=C/C(=C)C)=C(C)C |
| InChI | InChI=1S/C15H22N4/c1-8-13(10-11(3)4)18-15(16-7)19-14(12(5)6)17-9-2/h8-10,17H,1-3,7H2,4-6H3,(H,18,19)/b13-10+ |
| InChIKey | OPNNKERNGHFJMX-JLHYYAGUSA-N |
| XLogP | 3.26 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|