C10H16N2 — CID 123513176
N-but-2-en-2-yl-N'-[(1Z)-3-methylbuta-1,3-dienyl]methanimidamide (PubChem CID 123513176) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-but-2-en-2-yl-N'-[(1Z)-3-methylbuta-1,3-dienyl]methanimidamide.
| Compound Name | N-but-2-en-2-yl-N'-[(1Z)-3-methylbuta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 123513176 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-but-2-en-2-yl-N'-[(1Z)-3-methylbuta-1,3-dienyl]methanimidamide |
| SMILES | C=C(C)/C=C\N=C\NC(C)=CC |
| InChI | InChI=1S/C10H16N2/c1-5-10(4)12-8-11-7-6-9(2)3/h5-8H,2H2,1,3-4H3,(H,11,12)/b7-6-,10-5? |
| InChIKey | RFIHPIFMRPPTCS-MHOVPGDZSA-N |
| XLogP | 2.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|