C11H19N3 — CID 145222589
N',4-dimethyl-2-methylidenepyridine-1-carboximidamide;ethane (PubChem CID 145222589) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N',4-dimethyl-2-methylidenepyridine-1-carboximidamide;ethane.
| Compound Name | N',4-dimethyl-2-methylidenepyridine-1-carboximidamide;ethane |
|---|---|
| PubChem CID | 145222589 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N',4-dimethyl-2-methylidenepyridine-1-carboximidamide;ethane |
| SMILES | C=C1C=C(C)C=CN1/C(N)=N/C.CC |
| InChI | InChI=1S/C9H13N3.C2H6/c1-7-4-5-12(8(2)6-7)9(10)11-3;1-2/h4-6H,2H2,1,3H3,(H2,10,11);1-2H3 |
| InChIKey | FGJDFJQZZMIRER-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|