C10H12N5Y- — CID 59107798
1-(4-methylbenzene-5-id-1-yl)-2H-1,3,5-triazine-4,6-diamine;yttrium (PubChem CID 59107798) has the molecular formula C10H12N5Y- and a molecular weight of 291.15 g/mol. Its IUPAC name is 1-(4-methylbenzene-5-id-1-yl)-2H-1,3,5-triazine-4,6-diamine;yttrium.
| Compound Name | 1-(4-methylbenzene-5-id-1-yl)-2H-1,3,5-triazine-4,6-diamine;yttrium |
|---|---|
| PubChem CID | 59107798 |
| Molecular Formula | C10H12N5Y- |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 1-(4-methylbenzene-5-id-1-yl)-2H-1,3,5-triazine-4,6-diamine;yttrium |
| SMILES | Cc1[c-]cc(N2CN=C(N)N=C2N)cc1.[Y] |
| InChI | InChI=1S/C10H12N5.Y/c1-7-2-4-8(5-3-7)15-6-13-9(11)14-10(15)12;/h2,4-5H,6H2,1H3,(H4,11,12,13,14);/q-1; |
| InChIKey | AKTFWBNMODAITH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|