C10H15N5 — CID 157171984
6-N-cyclopenta-1,4-dien-1-yl-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 157171984) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-N-cyclopenta-1,4-dien-1-yl-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 6-N-cyclopenta-1,4-dien-1-yl-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 157171984 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 6-N-cyclopenta-1,4-dien-1-yl-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CC1N=C(N)NC(N(C)C2=CCC=C2)=N1 |
| InChI | InChI=1S/C10H15N5/c1-7-12-9(11)14-10(13-7)15(2)8-5-3-4-6-8/h3,5-7H,4H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | VCCJFYLJLLICEV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |