C9H18N4 — CID 146777793
N-methyl-1-[(3,4,6-trimethyl-1,4-dihydropyrimidin-2-ylidene)amino]methanamine (PubChem CID 146777793) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is N-methyl-1-[(3,4,6-trimethyl-1,4-dihydropyrimidin-2-ylidene)amino]methanamine.
| Compound Name | N-methyl-1-[(3,4,6-trimethyl-1,4-dihydropyrimidin-2-ylidene)amino]methanamine |
|---|---|
| PubChem CID | 146777793 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N-methyl-1-[(3,4,6-trimethyl-1,4-dihydropyrimidin-2-ylidene)amino]methanamine |
| SMILES | CNCN=C1NC(C)=CC(C)N1C |
| InChI | InChI=1S/C9H18N4/c1-7-5-8(2)13(4)9(12-7)11-6-10-3/h5,8,10H,6H2,1-4H3,(H,11,12) |
| InChIKey | RTBIVCNZASWIKN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|