C10H21N3 — CID 123410965
1,1,2-trimethyl-3-(3-methylpent-3-en-2-yl)guanidine (PubChem CID 123410965) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-(3-methylpent-3-en-2-yl)guanidine.
| Compound Name | 1,1,2-trimethyl-3-(3-methylpent-3-en-2-yl)guanidine |
|---|---|
| PubChem CID | 123410965 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1,1,2-trimethyl-3-(3-methylpent-3-en-2-yl)guanidine |
| SMILES | CC=C(C)C(C)N/C(=N/C)N(C)C |
| InChI | InChI=1S/C10H21N3/c1-7-8(2)9(3)12-10(11-4)13(5)6/h7,9H,1-6H3,(H,11,12) |
| InChIKey | PMIXIJHVRFPVDI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|